C19H25NO7S — CID 158354315
5,5-dimethoxy-1-[[2-(4-methoxyphenyl)-5-methyl-1,3-oxazol-4-yl]methylsulfonyl]pentan-2-one (PubChem CID 158354315) has the molecular formula C19H25NO7S and a molecular weight of 411.48 g/mol. Its IUPAC name is 5,5-dimethoxy-1-[[2-(4-methoxyphenyl)-5-methyl-1,3-oxazol-4-yl]methylsulfonyl]pentan-2-one.
| Compound Name | 5,5-dimethoxy-1-[[2-(4-methoxyphenyl)-5-methyl-1,3-oxazol-4-yl]methylsulfonyl]pentan-2-one |
|---|---|
| PubChem CID | 158354315 |
| Molecular Formula | C19H25NO7S |
| Molecular Weight | 411.48 g/mol |
| Exact Mass | 411.14 |
| IUPAC Name | 5,5-dimethoxy-1-[[2-(4-methoxyphenyl)-5-methyl-1,3-oxazol-4-yl]methylsulfonyl]pentan-2-one |
| SMILES | COc1ccc(-c2nc(CS(=O)(=O)CC(=O)CCC(OC)OC)c(C)o2)cc1 |
| InChI | InChI=1S/C19H25NO7S/c1-13-17(20-19(27-13)14-5-8-16(24-2)9-6-14)12-28(22,23)11-15(21)7-10-18(25-3)26-4/h5-6,8-9,18H,7,10-12H2,1-4H3 |
| InChIKey | GSRQAYXDPJELIE-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 104.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.48 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|