C22H25F7N2O3S — CID 152844272
7-amino-8,8,8-trifluoro-1-[3-[2-[3-fluoro-5-(trifluoromethyl)phenyl]sulfonylpropan-2-yl]cyclobutyl]-5-iminooct-6-en-4-one (PubChem CID 152844272) has the molecular formula C22H25F7N2O3S and a molecular weight of 530.51 g/mol. Its IUPAC name is 7-amino-8,8,8-trifluoro-1-[3-[2-[3-fluoro-5-(trifluoromethyl)phenyl]sulfonylpropan-2-yl]cyclobutyl]-5-iminooct-6-en-4-one.
| Compound Name | 7-amino-8,8,8-trifluoro-1-[3-[2-[3-fluoro-5-(trifluoromethyl)phenyl]sulfonylpropan-2-yl]cyclobutyl]-5-iminooct-6-en-4-one |
|---|---|
| PubChem CID | 152844272 |
| Molecular Formula | C22H25F7N2O3S |
| Molecular Weight | 530.51 g/mol |
| Exact Mass | 530.15 |
| IUPAC Name | 7-amino-8,8,8-trifluoro-1-[3-[2-[3-fluoro-5-(trifluoromethyl)phenyl]sulfonylpropan-2-yl]cyclobutyl]-5-iminooct-6-en-4-one |
| SMILES | [H]/N=C(\C=C(N)C(F)(F)F)C(=O)CCCC1CC(C(C)(C)S(=O)(=O)c2cc(F)cc(C(F)(F)F)c2)C1 |
| InChI | InChI=1S/C22H25F7N2O3S/c1-20(2,35(33,34)16-9-14(21(24,25)26)8-15(23)10-16)13-6-12(7-13)4-3-5-18(32)17(30)11-19(31)22(27,28)29/h8-13,30H,3-7,31H2,1-2H3/b19-11?,30-17+ |
| InChIKey | LYEBCZJECOEYHJ-LQUIMNMZSA-N |
| XLogP | 5.59 |
| TPSA | 101.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.51 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|