C15H21BrO3 — CID 152845231
(4-bromophenyl)methyl 2-methylhexan-2-yl carbonate (PubChem CID 152845231) has the molecular formula C15H21BrO3 and a molecular weight of 329.23 g/mol. Its IUPAC name is (4-bromophenyl)methyl 2-methylhexan-2-yl carbonate.
| Compound Name | (4-bromophenyl)methyl 2-methylhexan-2-yl carbonate |
|---|---|
| PubChem CID | 152845231 |
| Molecular Formula | C15H21BrO3 |
| Molecular Weight | 329.23 g/mol |
| Exact Mass | 328.07 |
| IUPAC Name | (4-bromophenyl)methyl 2-methylhexan-2-yl carbonate |
| SMILES | CCCCC(C)(C)OC(=O)OCc1ccc(Br)cc1 |
| InChI | InChI=1S/C15H21BrO3/c1-4-5-10-15(2,3)19-14(17)18-11-12-6-8-13(16)9-7-12/h6-9H,4-5,10-11H2,1-3H3 |
| InChIKey | TTXMDLMTOBXTID-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.23 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |