C19H17N — CID 152848775
9-(6-methylcyclohexa-1,3-dien-1-yl)carbazole (PubChem CID 152848775) has the molecular formula C19H17N and a molecular weight of 259.35 g/mol. Its IUPAC name is 9-(6-methylcyclohexa-1,3-dien-1-yl)carbazole.
| Compound Name | 9-(6-methylcyclohexa-1,3-dien-1-yl)carbazole |
|---|---|
| PubChem CID | 152848775 |
| Molecular Formula | C19H17N |
| Molecular Weight | 259.35 g/mol |
| Exact Mass | 259.14 |
| IUPAC Name | 9-(6-methylcyclohexa-1,3-dien-1-yl)carbazole |
| SMILES | CC1CC=CC=C1n1c2ccccc2c2ccccc21 |
| InChI | InChI=1S/C19H17N/c1-14-8-2-5-11-17(14)20-18-12-6-3-9-15(18)16-10-4-7-13-19(16)20/h2-7,9-14H,8H2,1H3 |
| InChIKey | TUTREBZCNGVYGH-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.35 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |