C21H22Cl2F3N3O4S — CID 152858389
(2R,5R)-2-(2,4-dichlorophenyl)sulfanyl-6-(hydroxymethyl)-4-[[(Z)-2-(2-methylhydrazinyl)-2-(3,4,5-trifluorophenyl)ethenyl]amino]oxane-3,5-diol (PubChem CID 152858389) has the molecular formula C21H22Cl2F3N3O4S and a molecular weight of 540.39 g/mol. Its IUPAC name is (2R,5R)-2-(2,4-dichlorophenyl)sulfanyl-6-(hydroxymethyl)-4-[[(Z)-2-(2-methylhydrazinyl)-2-(3,4,5-trifluorophenyl)ethenyl]amino]oxane-3,5-diol.
| Compound Name | (2R,5R)-2-(2,4-dichlorophenyl)sulfanyl-6-(hydroxymethyl)-4-[[(Z)-2-(2-methylhydrazinyl)-2-(3,4,5-trifluorophenyl)ethenyl]amino]oxane-3,5-diol |
|---|---|
| PubChem CID | 152858389 |
| Molecular Formula | C21H22Cl2F3N3O4S |
| Molecular Weight | 540.39 g/mol |
| Exact Mass | 539.07 |
| IUPAC Name | (2R,5R)-2-(2,4-dichlorophenyl)sulfanyl-6-(hydroxymethyl)-4-[[(Z)-2-(2-methylhydrazinyl)-2-(3,4,5-trifluorophenyl)ethenyl]amino]oxane-3,5-diol |
| SMILES | CNN/C(=C\NC1C(O)[C@@H](Sc2ccc(Cl)cc2Cl)OC(CO)[C@@H]1O)c1cc(F)c(F)c(F)c1 |
| InChI | InChI=1S/C21H22Cl2F3N3O4S/c1-27-29-14(9-4-12(24)17(26)13(25)5-9)7-28-18-19(31)15(8-30)33-21(20(18)32)34-16-3-2-10(22)6-11(16)23/h2-7,15,18-21,27-32H,8H2,1H3/b14-7-/t15?,18?,19-,20?,21+/m0/s1 |
| InChIKey | TXAOUWLSBMIGCW-BUPZGMACSA-N |
| XLogP | 2.62 |
| TPSA | 106.01 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.39 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|