C20H24ClN3O3 — CID 152863381
tert-butyl 2-[2-[[2-chloro-5-(1-ethoxyethenyl)pyrimidin-4-yl]amino]phenyl]acetate (PubChem CID 152863381) has the molecular formula C20H24ClN3O3 and a molecular weight of 389.88 g/mol. Its IUPAC name is tert-butyl 2-[2-[[2-chloro-5-(1-ethoxyethenyl)pyrimidin-4-yl]amino]phenyl]acetate.
| Compound Name | tert-butyl 2-[2-[[2-chloro-5-(1-ethoxyethenyl)pyrimidin-4-yl]amino]phenyl]acetate |
|---|---|
| PubChem CID | 152863381 |
| Molecular Formula | C20H24ClN3O3 |
| Molecular Weight | 389.88 g/mol |
| Exact Mass | 389.15 |
| IUPAC Name | tert-butyl 2-[2-[[2-chloro-5-(1-ethoxyethenyl)pyrimidin-4-yl]amino]phenyl]acetate |
| SMILES | C=C(OCC)c1cnc(Cl)nc1Nc1ccccc1CC(=O)OC(C)(C)C |
| InChI | InChI=1S/C20H24ClN3O3/c1-6-26-13(2)15-12-22-19(21)24-18(15)23-16-10-8-7-9-14(16)11-17(25)27-20(3,4)5/h7-10,12H,2,6,11H2,1,3-5H3,(H,22,23,24) |
| InChIKey | TXZFLBWNXMLGAV-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.88 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|