C17H29NO3 — CID 15286430
tert-butyl (2R,6S)-2-[(1E,3Z,5S)-5-hydroxyhexa-1,3-dienyl]-6-methylpiperidine-1-carboxylate (PubChem CID 15286430) has the molecular formula C17H29NO3 and a molecular weight of 295.42 g/mol. Its IUPAC name is tert-butyl (2R,6S)-2-[(1E,3Z,5S)-5-hydroxyhexa-1,3-dienyl]-6-methylpiperidine-1-carboxylate.
| Compound Name | tert-butyl (2R,6S)-2-[(1E,3Z,5S)-5-hydroxyhexa-1,3-dienyl]-6-methylpiperidine-1-carboxylate |
|---|---|
| PubChem CID | 15286430 |
| Molecular Formula | C17H29NO3 |
| Molecular Weight | 295.42 g/mol |
| Exact Mass | 295.21 |
| IUPAC Name | tert-butyl (2R,6S)-2-[(1E,3Z,5S)-5-hydroxyhexa-1,3-dienyl]-6-methylpiperidine-1-carboxylate |
| SMILES | C[C@H](O)/C=C\C=C\[C@H]1CCC[C@H](C)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C17H29NO3/c1-13-9-8-12-15(11-7-6-10-14(2)19)18(13)16(20)21-17(3,4)5/h6-7,10-11,13-15,19H,8-9,12H2,1-5H3/b10-6-,11-7+/t13-,14-,15-/m0/s1 |
| InChIKey | ARSIQBPOSPVQRC-JSTOGZBVSA-N |
| XLogP | 3.66 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.42 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|