C17H27NO3 — CID 101119217
tert-butyl (2S,6S)-2-[(E,5S)-5-hydroxyhex-1-en-3-ynyl]-6-methylpiperidine-1-carboxylate (PubChem CID 101119217) has the molecular formula C17H27NO3 and a molecular weight of 293.41 g/mol. Its IUPAC name is tert-butyl (2S,6S)-2-[(E,5S)-5-hydroxyhex-1-en-3-ynyl]-6-methylpiperidine-1-carboxylate.
| Compound Name | tert-butyl (2S,6S)-2-[(E,5S)-5-hydroxyhex-1-en-3-ynyl]-6-methylpiperidine-1-carboxylate |
|---|---|
| PubChem CID | 101119217 |
| Molecular Formula | C17H27NO3 |
| Molecular Weight | 293.41 g/mol |
| Exact Mass | 293.20 |
| IUPAC Name | tert-butyl (2S,6S)-2-[(E,5S)-5-hydroxyhex-1-en-3-ynyl]-6-methylpiperidine-1-carboxylate |
| SMILES | C[C@H](O)C#C/C=C/[C@@H]1CCC[C@H](C)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C17H27NO3/c1-13-9-8-12-15(11-7-6-10-14(2)19)18(13)16(20)21-17(3,4)5/h7,11,13-15,19H,8-9,12H2,1-5H3/b11-7+/t13-,14-,15+/m0/s1 |
| InChIKey | YJRYORVMSMJJFW-NKTIKSMOSA-N |
| XLogP | 3.10 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.41 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|