C35H37FN2O5 — CID 152872951
(2R)-4-(2-fluoro-4-methoxyphenyl)-2-[[4-[5-(4-heptoxyphenyl)pyrimidin-2-yl]phenyl]methyl]-4-oxobutanoic acid (PubChem CID 152872951) has the molecular formula C35H37FN2O5 and a molecular weight of 584.69 g/mol. Its IUPAC name is (2R)-4-(2-fluoro-4-methoxyphenyl)-2-[[4-[5-(4-heptoxyphenyl)pyrimidin-2-yl]phenyl]methyl]-4-oxobutanoic acid.
| Compound Name | (2R)-4-(2-fluoro-4-methoxyphenyl)-2-[[4-[5-(4-heptoxyphenyl)pyrimidin-2-yl]phenyl]methyl]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 152872951 |
| Molecular Formula | C35H37FN2O5 |
| Molecular Weight | 584.69 g/mol |
| Exact Mass | 584.27 |
| IUPAC Name | (2R)-4-(2-fluoro-4-methoxyphenyl)-2-[[4-[5-(4-heptoxyphenyl)pyrimidin-2-yl]phenyl]methyl]-4-oxobutanoic acid |
| SMILES | CCCCCCCOc1ccc(-c2cnc(-c3ccc(CC(CC(=O)c4ccc(OC)cc4F)C(=O)O)cc3)nc2)cc1 |
| InChI | InChI=1S/C35H37FN2O5/c1-3-4-5-6-7-18-43-29-14-12-25(13-15-29)28-22-37-34(38-23-28)26-10-8-24(9-11-26)19-27(35(40)41)20-33(39)31-17-16-30(42-2)21-32(31)36/h8-17,21-23,27H,3-7,18-20H2,1-2H3,(H,40,41) |
| InChIKey | TZTJINADVQFRDB-UHFFFAOYSA-N |
| XLogP | 7.82 |
| TPSA | 98.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.69 |
| LogP ≤ 5 | 7.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|