C13H16BNO3 — CID 152894287
CID 152894287 (PubChem CID 152894287) has the molecular formula C13H16BNO3 and a molecular weight of 245.09 g/mol.
| Compound Name | CID 152894287 |
|---|---|
| PubChem CID | 152894287 |
| Molecular Formula | C13H16BNO3 |
| Molecular Weight | 245.09 g/mol |
| Exact Mass | 245.12 |
| IUPAC Name | — |
| SMILES | [B]c1ccc(C(=O)N2CCC(O)CC2)cc1OC |
| InChI | InChI=1S/C13H16BNO3/c1-18-12-8-9(2-3-11(12)14)13(17)15-6-4-10(16)5-7-15/h2-3,8,10,16H,4-7H2,1H3 |
| InChIKey | LCZIQUARLFDNGE-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.09 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|