C11H16O2 — CID 152897390
4-methyl-3,3-bis(prop-2-enyl)oxolan-2-one (PubChem CID 152897390) has the molecular formula C11H16O2 and a molecular weight of 180.25 g/mol. Its IUPAC name is 4-methyl-3,3-bis(prop-2-enyl)oxolan-2-one.
| Compound Name | 4-methyl-3,3-bis(prop-2-enyl)oxolan-2-one |
|---|---|
| PubChem CID | 152897390 |
| Molecular Formula | C11H16O2 |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.12 |
| IUPAC Name | 4-methyl-3,3-bis(prop-2-enyl)oxolan-2-one |
| SMILES | C=CCC1(CC=C)C(=O)OCC1C |
| InChI | InChI=1S/C11H16O2/c1-4-6-11(7-5-2)9(3)8-13-10(11)12/h4-5,9H,1-2,6-8H2,3H3 |
| InChIKey | UEQQBECANZNUJU-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|