C41H55N3O9 — CID 152901351
2-methylpropyl 3-[(2S,4R)-2-[8-[(2-amino-2-oxo-1-phenylethyl)amino]-4,5,8-trioxo-3-propyloctanoyl]-4-phenylmethoxypyrrolidine-1-carbonyl]-4-methylpentanoate (PubChem CID 152901351) has the molecular formula C41H55N3O9 and a molecular weight of 733.90 g/mol. Its IUPAC name is 2-methylpropyl 3-[(2S,4R)-2-[8-[(2-amino-2-oxo-1-phenylethyl)amino]-4,5,8-trioxo-3-propyloctanoyl]-4-phenylmethoxypyrrolidine-1-carbonyl]-4-methylpentanoate.
| Compound Name | 2-methylpropyl 3-[(2S,4R)-2-[8-[(2-amino-2-oxo-1-phenylethyl)amino]-4,5,8-trioxo-3-propyloctanoyl]-4-phenylmethoxypyrrolidine-1-carbonyl]-4-methylpentanoate |
|---|---|
| PubChem CID | 152901351 |
| Molecular Formula | C41H55N3O9 |
| Molecular Weight | 733.90 g/mol |
| Exact Mass | 733.39 |
| IUPAC Name | 2-methylpropyl 3-[(2S,4R)-2-[8-[(2-amino-2-oxo-1-phenylethyl)amino]-4,5,8-trioxo-3-propyloctanoyl]-4-phenylmethoxypyrrolidine-1-carbonyl]-4-methylpentanoate |
| SMILES | CCCC(CC(=O)[C@@H]1C[C@@H](OCc2ccccc2)CN1C(=O)C(CC(=O)OCC(C)C)C(C)C)C(=O)C(=O)CCC(=O)NC(C(N)=O)c1ccccc1 |
| InChI | InChI=1S/C41H55N3O9/c1-6-13-30(39(49)34(45)18-19-36(47)43-38(40(42)50)29-16-11-8-12-17-29)20-35(46)33-21-31(52-25-28-14-9-7-10-15-28)23-44(33)41(51)32(27(4)5)22-37(48)53-24-26(2)3/h7-12,14-17,26-27,30-33,38H,6,13,18-25H2,1-5H3,(H2,42,50)(H,43,47)/t30?,31-,32?,33+,38?/m1/s1 |
| InChIKey | UFKCCDSISUILSU-RZDCNAOBSA-N |
| XLogP | 4.67 |
| TPSA | 179.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 53 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 733.90 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|