C39H53N3O8 — CID 160557259
2-methylpropyl 3-[(2S)-2-[8-[(1-amino-3-naphthalen-2-yl-1-oxopropan-2-yl)amino]-4,5,8-trioxo-3-propyloctanoyl]pyrrolidine-1-carbonyl]-4-methylpentanoate (PubChem CID 160557259) has the molecular formula C39H53N3O8 and a molecular weight of 691.87 g/mol. Its IUPAC name is 2-methylpropyl 3-[(2S)-2-[8-[(1-amino-3-naphthalen-2-yl-1-oxopropan-2-yl)amino]-4,5,8-trioxo-3-propyloctanoyl]pyrrolidine-1-carbonyl]-4-methylpentanoate.
| Compound Name | 2-methylpropyl 3-[(2S)-2-[8-[(1-amino-3-naphthalen-2-yl-1-oxopropan-2-yl)amino]-4,5,8-trioxo-3-propyloctanoyl]pyrrolidine-1-carbonyl]-4-methylpentanoate |
|---|---|
| PubChem CID | 160557259 |
| Molecular Formula | C39H53N3O8 |
| Molecular Weight | 691.87 g/mol |
| Exact Mass | 691.38 |
| IUPAC Name | 2-methylpropyl 3-[(2S)-2-[8-[(1-amino-3-naphthalen-2-yl-1-oxopropan-2-yl)amino]-4,5,8-trioxo-3-propyloctanoyl]pyrrolidine-1-carbonyl]-4-methylpentanoate |
| SMILES | CCCC(CC(=O)[C@@H]1CCCN1C(=O)C(CC(=O)OCC(C)C)C(C)C)C(=O)C(=O)CCC(=O)NC(Cc1ccc2ccccc2c1)C(N)=O |
| InChI | InChI=1S/C39H53N3O8/c1-6-10-29(21-34(44)32-13-9-18-42(32)39(49)30(25(4)5)22-36(46)50-23-24(2)3)37(47)33(43)16-17-35(45)41-31(38(40)48)20-26-14-15-27-11-7-8-12-28(27)19-26/h7-8,11-12,14-15,19,24-25,29-32H,6,9-10,13,16-18,20-23H2,1-5H3,(H2,40,48)(H,41,45)/t29?,30?,31?,32-/m0/s1 |
| InChIKey | QYVRIXRQBIARLG-OWXMFSIZSA-N |
| XLogP | 4.50 |
| TPSA | 170.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 50 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 691.87 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|