C43H67NO7 — CID 158919716
(10S)-1-[(2S)-1-[(2S)-2-tert-butyl-6,6-dimethyl-4-oxoheptanoyl]pyrrolidin-2-yl]-12-methyl-10-phenyl-3-propyltridecane-1,4,5,8,11-pentone;propane (PubChem CID 158919716) has the molecular formula C43H67NO7 and a molecular weight of 710.01 g/mol. Its IUPAC name is (10S)-1-[(2S)-1-[(2S)-2-tert-butyl-6,6-dimethyl-4-oxoheptanoyl]pyrrolidin-2-yl]-12-methyl-10-phenyl-3-propyltridecane-1,4,5,8,11-pentone;propane.
| Compound Name | (10S)-1-[(2S)-1-[(2S)-2-tert-butyl-6,6-dimethyl-4-oxoheptanoyl]pyrrolidin-2-yl]-12-methyl-10-phenyl-3-propyltridecane-1,4,5,8,11-pentone;propane |
|---|---|
| PubChem CID | 158919716 |
| Molecular Formula | C43H67NO7 |
| Molecular Weight | 710.01 g/mol |
| Exact Mass | 709.49 |
| IUPAC Name | (10S)-1-[(2S)-1-[(2S)-2-tert-butyl-6,6-dimethyl-4-oxoheptanoyl]pyrrolidin-2-yl]-12-methyl-10-phenyl-3-propyltridecane-1,4,5,8,11-pentone;propane |
| SMILES | CCC.CCCC(CC(=O)[C@@H]1CCCN1C(=O)[C@@H](CC(=O)CC(C)(C)C)C(C)(C)C)C(=O)C(=O)CCC(=O)C[C@H](C(=O)C(C)C)c1ccccc1 |
| InChI | InChI=1S/C40H59NO7.C3H8/c1-10-15-28(37(47)34(44)20-19-29(42)23-31(36(46)26(2)3)27-16-12-11-13-17-27)22-35(45)33-18-14-21-41(33)38(48)32(40(7,8)9)24-30(43)25-39(4,5)6;1-3-2/h11-13,16-17,26,28,31-33H,10,14-15,18-25H2,1-9H3;3H2,1-2H3/t28?,31-,32+,33-;/m0./s1 |
| InChIKey | JHRJGSTYHGGDTC-AJERPDEUSA-N |
| XLogP | 8.71 |
| TPSA | 122.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 710.01 |
| LogP ≤ 5 | 8.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|