C41H61NO7 — CID 58263191
(10S)-3-butyl-1-[(2S)-1-[(2S)-2-tert-butyl-6,6-dimethyl-4-oxoheptanoyl]pyrrolidin-2-yl]-12-methyl-10-phenyltridecane-1,4,5,8,11-pentone (PubChem CID 58263191) has the molecular formula C41H61NO7 and a molecular weight of 679.94 g/mol. Its IUPAC name is (10S)-3-butyl-1-[(2S)-1-[(2S)-2-tert-butyl-6,6-dimethyl-4-oxoheptanoyl]pyrrolidin-2-yl]-12-methyl-10-phenyltridecane-1,4,5,8,11-pentone.
| Compound Name | (10S)-3-butyl-1-[(2S)-1-[(2S)-2-tert-butyl-6,6-dimethyl-4-oxoheptanoyl]pyrrolidin-2-yl]-12-methyl-10-phenyltridecane-1,4,5,8,11-pentone |
|---|---|
| PubChem CID | 58263191 |
| Molecular Formula | C41H61NO7 |
| Molecular Weight | 679.94 g/mol |
| Exact Mass | 679.44 |
| IUPAC Name | (10S)-3-butyl-1-[(2S)-1-[(2S)-2-tert-butyl-6,6-dimethyl-4-oxoheptanoyl]pyrrolidin-2-yl]-12-methyl-10-phenyltridecane-1,4,5,8,11-pentone |
| SMILES | CCCCC(CC(=O)[C@@H]1CCCN1C(=O)[C@@H](CC(=O)CC(C)(C)C)C(C)(C)C)C(=O)C(=O)CCC(=O)C[C@H](C(=O)C(C)C)c1ccccc1 |
| InChI | InChI=1S/C41H61NO7/c1-10-11-16-29(38(48)35(45)21-20-30(43)24-32(37(47)27(2)3)28-17-13-12-14-18-28)23-36(46)34-19-15-22-42(34)39(49)33(41(7,8)9)25-31(44)26-40(4,5)6/h12-14,17-18,27,29,32-34H,10-11,15-16,19-26H2,1-9H3/t29?,32-,33+,34-/m0/s1 |
| InChIKey | JTZCEJROYIYIJR-HSRUTRRWSA-N |
| XLogP | 7.69 |
| TPSA | 122.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 679.94 |
| LogP ≤ 5 | 7.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|