C40H59NO7 — CID 58263200
(10S)-3-butyl-1-[(2S)-1-[(2S)-2-tert-butyl-6-methyl-4-oxoheptanoyl]pyrrolidin-2-yl]-12-methyl-10-phenyltridecane-1,4,5,8,11-pentone (PubChem CID 58263200) has the molecular formula C40H59NO7 and a molecular weight of 665.91 g/mol. Its IUPAC name is (10S)-3-butyl-1-[(2S)-1-[(2S)-2-tert-butyl-6-methyl-4-oxoheptanoyl]pyrrolidin-2-yl]-12-methyl-10-phenyltridecane-1,4,5,8,11-pentone.
| Compound Name | (10S)-3-butyl-1-[(2S)-1-[(2S)-2-tert-butyl-6-methyl-4-oxoheptanoyl]pyrrolidin-2-yl]-12-methyl-10-phenyltridecane-1,4,5,8,11-pentone |
|---|---|
| PubChem CID | 58263200 |
| Molecular Formula | C40H59NO7 |
| Molecular Weight | 665.91 g/mol |
| Exact Mass | 665.43 |
| IUPAC Name | (10S)-3-butyl-1-[(2S)-1-[(2S)-2-tert-butyl-6-methyl-4-oxoheptanoyl]pyrrolidin-2-yl]-12-methyl-10-phenyltridecane-1,4,5,8,11-pentone |
| SMILES | CCCCC(CC(=O)[C@@H]1CCCN1C(=O)[C@@H](CC(=O)CC(C)C)C(C)(C)C)C(=O)C(=O)CCC(=O)C[C@H](C(=O)C(C)C)c1ccccc1 |
| InChI | InChI=1S/C40H59NO7/c1-9-10-15-29(38(47)35(44)20-19-30(42)24-32(37(46)27(4)5)28-16-12-11-13-17-28)23-36(45)34-18-14-21-41(34)39(48)33(40(6,7)8)25-31(43)22-26(2)3/h11-13,16-17,26-27,29,32-34H,9-10,14-15,18-25H2,1-8H3/t29?,32-,33+,34-/m0/s1 |
| InChIKey | NGRJSSNBNSUPPN-HSRUTRRWSA-N |
| XLogP | 7.30 |
| TPSA | 122.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.91 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|