C37H46N4O6 — CID 162079015
N-(1-amino-3-naphthalen-2-yl-1-oxopropan-2-yl)-6-butan-2-yl-11-methyl-4,5,8-trioxo-9-[(2-pyridin-4-ylacetyl)amino]dodecanamide (PubChem CID 162079015) has the molecular formula C37H46N4O6 and a molecular weight of 642.80 g/mol. Its IUPAC name is N-(1-amino-3-naphthalen-2-yl-1-oxopropan-2-yl)-6-butan-2-yl-11-methyl-4,5,8-trioxo-9-[(2-pyridin-4-ylacetyl)amino]dodecanamide.
| Compound Name | N-(1-amino-3-naphthalen-2-yl-1-oxopropan-2-yl)-6-butan-2-yl-11-methyl-4,5,8-trioxo-9-[(2-pyridin-4-ylacetyl)amino]dodecanamide |
|---|---|
| PubChem CID | 162079015 |
| Molecular Formula | C37H46N4O6 |
| Molecular Weight | 642.80 g/mol |
| Exact Mass | 642.34 |
| IUPAC Name | N-(1-amino-3-naphthalen-2-yl-1-oxopropan-2-yl)-6-butan-2-yl-11-methyl-4,5,8-trioxo-9-[(2-pyridin-4-ylacetyl)amino]dodecanamide |
| SMILES | CCC(C)C(CC(=O)C(CC(C)C)NC(=O)Cc1ccncc1)C(=O)C(=O)CCC(=O)NC(Cc1ccc2ccccc2c1)C(N)=O |
| InChI | InChI=1S/C37H46N4O6/c1-5-24(4)29(22-33(43)30(18-23(2)3)40-35(45)21-25-14-16-39-17-15-25)36(46)32(42)12-13-34(44)41-31(37(38)47)20-26-10-11-27-8-6-7-9-28(27)19-26/h6-11,14-17,19,23-24,29-31H,5,12-13,18,20-22H2,1-4H3,(H2,38,47)(H,40,45)(H,41,44) |
| InChIKey | ZCBXVMHNEIGXFS-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 165.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.80 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|