C16H20F3NO — CID 152909301
(3R,8aS)-6-ethyl-7,7-difluoro-3-(3-fluorophenyl)-2,3,5,6,8,8a-hexahydro-1H-indolizin-5-ol (PubChem CID 152909301) has the molecular formula C16H20F3NO and a molecular weight of 299.34 g/mol. Its IUPAC name is (3R,8aS)-6-ethyl-7,7-difluoro-3-(3-fluorophenyl)-2,3,5,6,8,8a-hexahydro-1H-indolizin-5-ol.
| Compound Name | (3R,8aS)-6-ethyl-7,7-difluoro-3-(3-fluorophenyl)-2,3,5,6,8,8a-hexahydro-1H-indolizin-5-ol |
|---|---|
| PubChem CID | 152909301 |
| Molecular Formula | C16H20F3NO |
| Molecular Weight | 299.34 g/mol |
| Exact Mass | 299.15 |
| IUPAC Name | (3R,8aS)-6-ethyl-7,7-difluoro-3-(3-fluorophenyl)-2,3,5,6,8,8a-hexahydro-1H-indolizin-5-ol |
| SMILES | CCC1C(O)N2[C@@H](CC[C@@H]2c2cccc(F)c2)CC1(F)F |
| InChI | InChI=1S/C16H20F3NO/c1-2-13-15(21)20-12(9-16(13,18)19)6-7-14(20)10-4-3-5-11(17)8-10/h3-5,8,12-15,21H,2,6-7,9H2,1H3/t12-,13?,14+,15?/m0/s1 |
| InChIKey | UGWLLJISZBJEIX-FGZQJIAISA-N |
| XLogP | 3.71 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.34 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |