C21H27N5O3S — CID 152924752
2-[2-[(4S)-2-amino-4,6,6-trimethyl-5H-1,3-thiazin-4-yl]-4-pyridinyl]-1-[5-(2-methoxyethoxy)pyrazin-2-yl]ethanone (PubChem CID 152924752) has the molecular formula C21H27N5O3S and a molecular weight of 429.55 g/mol. Its IUPAC name is 2-[2-[(4S)-2-amino-4,6,6-trimethyl-5H-1,3-thiazin-4-yl]-4-pyridinyl]-1-[5-(2-methoxyethoxy)pyrazin-2-yl]ethanone.
| Compound Name | 2-[2-[(4S)-2-amino-4,6,6-trimethyl-5H-1,3-thiazin-4-yl]-4-pyridinyl]-1-[5-(2-methoxyethoxy)pyrazin-2-yl]ethanone |
|---|---|
| PubChem CID | 152924752 |
| Molecular Formula | C21H27N5O3S |
| Molecular Weight | 429.55 g/mol |
| Exact Mass | 429.18 |
| IUPAC Name | 2-[2-[(4S)-2-amino-4,6,6-trimethyl-5H-1,3-thiazin-4-yl]-4-pyridinyl]-1-[5-(2-methoxyethoxy)pyrazin-2-yl]ethanone |
| SMILES | COCCOc1cnc(C(=O)Cc2ccnc([C@]3(C)CC(C)(C)SC(N)=N3)c2)cn1 |
| InChI | InChI=1S/C21H27N5O3S/c1-20(2)13-21(3,26-19(22)30-20)17-10-14(5-6-23-17)9-16(27)15-11-25-18(12-24-15)29-8-7-28-4/h5-6,10-12H,7-9,13H2,1-4H3,(H2,22,26)/t21-/m0/s1 |
| InChIKey | UJUHUHMHYFTTOG-NRFANRHFSA-N |
| XLogP | 2.77 |
| TPSA | 112.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.55 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|