C26H19N5O — CID 152937093
3-[[4-[2-oxo-2-(6-phenyl-1H-indazol-3-yl)ethyl]pyrazol-1-yl]methyl]benzonitrile (PubChem CID 152937093) has the molecular formula C26H19N5O and a molecular weight of 417.47 g/mol. Its IUPAC name is 3-[[4-[2-oxo-2-(6-phenyl-1H-indazol-3-yl)ethyl]pyrazol-1-yl]methyl]benzonitrile.
| Compound Name | 3-[[4-[2-oxo-2-(6-phenyl-1H-indazol-3-yl)ethyl]pyrazol-1-yl]methyl]benzonitrile |
|---|---|
| PubChem CID | 152937093 |
| Molecular Formula | C26H19N5O |
| Molecular Weight | 417.47 g/mol |
| Exact Mass | 417.16 |
| IUPAC Name | 3-[[4-[2-oxo-2-(6-phenyl-1H-indazol-3-yl)ethyl]pyrazol-1-yl]methyl]benzonitrile |
| SMILES | N#Cc1cccc(Cn2cc(CC(=O)c3n[nH]c4cc(-c5ccccc5)ccc34)cn2)c1 |
| InChI | InChI=1S/C26H19N5O/c27-14-18-5-4-6-19(11-18)16-31-17-20(15-28-31)12-25(32)26-23-10-9-22(13-24(23)29-30-26)21-7-2-1-3-8-21/h1-11,13,15,17H,12,16H2,(H,29,30) |
| InChIKey | UMBNTLLDDPARRN-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 87.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.47 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |