C25H26N4O — CID 158480844
2-[1-[[3-(2-cyclobutylethyl)phenyl]methyl]pyrazol-4-yl]-1-(1H-indazol-3-yl)ethanone (PubChem CID 158480844) has the molecular formula C25H26N4O and a molecular weight of 398.51 g/mol. Its IUPAC name is 2-[1-[[3-(2-cyclobutylethyl)phenyl]methyl]pyrazol-4-yl]-1-(1H-indazol-3-yl)ethanone.
| Compound Name | 2-[1-[[3-(2-cyclobutylethyl)phenyl]methyl]pyrazol-4-yl]-1-(1H-indazol-3-yl)ethanone |
|---|---|
| PubChem CID | 158480844 |
| Molecular Formula | C25H26N4O |
| Molecular Weight | 398.51 g/mol |
| Exact Mass | 398.21 |
| IUPAC Name | 2-[1-[[3-(2-cyclobutylethyl)phenyl]methyl]pyrazol-4-yl]-1-(1H-indazol-3-yl)ethanone |
| SMILES | O=C(Cc1cnn(Cc2cccc(CCC3CCC3)c2)c1)c1n[nH]c2ccccc12 |
| InChI | InChI=1S/C25H26N4O/c30-24(25-22-9-1-2-10-23(22)27-28-25)14-21-15-26-29(17-21)16-20-8-4-7-19(13-20)12-11-18-5-3-6-18/h1-2,4,7-10,13,15,17-18H,3,5-6,11-12,14,16H2,(H,27,28) |
| InChIKey | HHMSSOLCYSZAGD-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 63.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.51 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |