C15H20O5 — CID 152941121
methyl 5-(2,3-dimethoxy-4-methylphenyl)-4-oxopentanoate (PubChem CID 152941121) has the molecular formula C15H20O5 and a molecular weight of 280.32 g/mol. Its IUPAC name is methyl 5-(2,3-dimethoxy-4-methylphenyl)-4-oxopentanoate.
| Compound Name | methyl 5-(2,3-dimethoxy-4-methylphenyl)-4-oxopentanoate |
|---|---|
| PubChem CID | 152941121 |
| Molecular Formula | C15H20O5 |
| Molecular Weight | 280.32 g/mol |
| Exact Mass | 280.13 |
| IUPAC Name | methyl 5-(2,3-dimethoxy-4-methylphenyl)-4-oxopentanoate |
| SMILES | COC(=O)CCC(=O)Cc1ccc(C)c(OC)c1OC |
| InChI | InChI=1S/C15H20O5/c1-10-5-6-11(15(20-4)14(10)19-3)9-12(16)7-8-13(17)18-2/h5-6H,7-9H2,1-4H3 |
| InChIKey | UMVAZTFRWRWCTF-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.32 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |