About 3-(hydroxymethyl)-7-methyltricyclo[3.3.1.01,3]nonan-5-ol
3-(hydroxymethyl)-7-methyltricyclo[3.3.1.01,3]nonan-5-ol (PubChem CID 152947818) has the molecular formula C11H18O2
and a molecular weight of 182.26 g/mol. Its IUPAC name is 3-(hydroxymethyl)-7-methyltricyclo[3.3.1.01,3]nonan-5-ol.
Analyze 3-(hydroxymethyl)-7-methyltricyclo[3.3.1.01,3]nonan-5-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(hydroxymethyl)-7-methyltricyclo[3.3.1.01,3]nonan-5-ol?
The IUPAC name of 3-(hydroxymethyl)-7-methyltricyclo[3.3.1.01,3]nonan-5-ol (CID 152947818) is 3-(hydroxymethyl)-7-methyltricyclo[3.3.1.01,3]nonan-5-ol.
What is the SMILES notation for 3-(hydroxymethyl)-7-methyltricyclo[3.3.1.01,3]nonan-5-ol?
The canonical SMILES for 3-(hydroxymethyl)-7-methyltricyclo[3.3.1.01,3]nonan-5-ol is CC1CC2(O)CC3(CO)CC3(C1)C2.
What is the InChIKey of 3-(hydroxymethyl)-7-methyltricyclo[3.3.1.01,3]nonan-5-ol?
The InChIKey is UOCGFJMGURFMIR-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18O2/c1-8-2-9-4-10(9,7-12)6-11(13,3-8)5-9/h8,12-13H,2-7H2,1H3.
What are the key properties of 3-(hydroxymethyl)-7-methyltricyclo[3.3.1.01,3]nonan-5-ol?
3-(hydroxymethyl)-7-methyltricyclo[3.3.1.01,3]nonan-5-ol has a molecular weight of 182.26 g/mol, XLogP of 1.31, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(hydroxymethyl)-7-methyltricyclo[3.3.1.01,3]nonan-5-ol is sourced from PubChem (CID 152947818), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).