C29H38IN5O2 — CID 15295738
2-(4-amino-3-iodophenyl)-N-[5-[2-[(4-methoxyphenyl)methyl-pyridin-2-ylamino]ethyl-methylamino]pentyl]acetamide (PubChem CID 15295738) has the molecular formula C29H38IN5O2 and a molecular weight of 615.56 g/mol. Its IUPAC name is 2-(4-amino-3-iodophenyl)-N-[5-[2-[(4-methoxyphenyl)methyl-pyridin-2-ylamino]ethyl-methylamino]pentyl]acetamide.
| Compound Name | 2-(4-amino-3-iodophenyl)-N-[5-[2-[(4-methoxyphenyl)methyl-pyridin-2-ylamino]ethyl-methylamino]pentyl]acetamide |
|---|---|
| PubChem CID | 15295738 |
| Molecular Formula | C29H38IN5O2 |
| Molecular Weight | 615.56 g/mol |
| Exact Mass | 615.21 |
| IUPAC Name | 2-(4-amino-3-iodophenyl)-N-[5-[2-[(4-methoxyphenyl)methyl-pyridin-2-ylamino]ethyl-methylamino]pentyl]acetamide |
| SMILES | COc1ccc(CN(CCN(C)CCCCCNC(=O)Cc2ccc(N)c(I)c2)c2ccccn2)cc1 |
| InChI | InChI=1S/C29H38IN5O2/c1-34(17-7-3-5-16-33-29(36)21-24-11-14-27(31)26(30)20-24)18-19-35(28-8-4-6-15-32-28)22-23-9-12-25(37-2)13-10-23/h4,6,8-15,20H,3,5,7,16-19,21-22,31H2,1-2H3,(H,33,36) |
| InChIKey | XNHDZEWWDRUXSZ-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 83.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.56 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|