C35H32N2O4 — CID 15296786
2-[bis(4-hydroxyphenyl)methyl]-N-[6-(4-tert-butylphenoxy)-3-pyridinyl]benzamide (PubChem CID 15296786) has the molecular formula C35H32N2O4 and a molecular weight of 544.65 g/mol. Its IUPAC name is 2-[bis(4-hydroxyphenyl)methyl]-N-[6-(4-tert-butylphenoxy)-3-pyridinyl]benzamide.
| Compound Name | 2-[bis(4-hydroxyphenyl)methyl]-N-[6-(4-tert-butylphenoxy)-3-pyridinyl]benzamide |
|---|---|
| PubChem CID | 15296786 |
| Molecular Formula | C35H32N2O4 |
| Molecular Weight | 544.65 g/mol |
| Exact Mass | 544.24 |
| IUPAC Name | 2-[bis(4-hydroxyphenyl)methyl]-N-[6-(4-tert-butylphenoxy)-3-pyridinyl]benzamide |
| SMILES | CC(C)(C)c1ccc(Oc2ccc(NC(=O)c3ccccc3C(c3ccc(O)cc3)c3ccc(O)cc3)cn2)cc1 |
| InChI | InChI=1S/C35H32N2O4/c1-35(2,3)25-12-19-29(20-13-25)41-32-21-14-26(22-36-32)37-34(40)31-7-5-4-6-30(31)33(23-8-15-27(38)16-9-23)24-10-17-28(39)18-11-24/h4-22,33,38-39H,1-3H3,(H,37,40) |
| InChIKey | PBPKRVQJKRVMJF-UHFFFAOYSA-N |
| XLogP | 8.02 |
| TPSA | 91.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.65 |
| LogP ≤ 5 | 8.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|