C31H25N3O2 — CID 150187824
N-[6-[4-(methylamino)phenoxy]-3-pyridinyl]-2-(4-phenylphenyl)benzamide (PubChem CID 150187824) has the molecular formula C31H25N3O2 and a molecular weight of 471.56 g/mol. Its IUPAC name is N-[6-[4-(methylamino)phenoxy]-3-pyridinyl]-2-(4-phenylphenyl)benzamide.
| Compound Name | N-[6-[4-(methylamino)phenoxy]-3-pyridinyl]-2-(4-phenylphenyl)benzamide |
|---|---|
| PubChem CID | 150187824 |
| Molecular Formula | C31H25N3O2 |
| Molecular Weight | 471.56 g/mol |
| Exact Mass | 471.19 |
| IUPAC Name | N-[6-[4-(methylamino)phenoxy]-3-pyridinyl]-2-(4-phenylphenyl)benzamide |
| SMILES | CNc1ccc(Oc2ccc(NC(=O)c3ccccc3-c3ccc(-c4ccccc4)cc3)cn2)cc1 |
| InChI | InChI=1S/C31H25N3O2/c1-32-25-15-18-27(19-16-25)36-30-20-17-26(21-33-30)34-31(35)29-10-6-5-9-28(29)24-13-11-23(12-14-24)22-7-3-2-4-8-22/h2-21,32H,1H3,(H,34,35) |
| InChIKey | FMULGPWRUKEAHX-UHFFFAOYSA-N |
| XLogP | 7.50 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.56 |
| LogP ≤ 5 | 7.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |