C26H22N2O3 — CID 173468677
N-[6-(2,3-dimethylphenoxy)-3-pyridinyl]-4-phenoxybenzamide (PubChem CID 173468677) has the molecular formula C26H22N2O3 and a molecular weight of 410.47 g/mol. Its IUPAC name is N-[6-(2,3-dimethylphenoxy)-3-pyridinyl]-4-phenoxybenzamide.
| Compound Name | N-[6-(2,3-dimethylphenoxy)-3-pyridinyl]-4-phenoxybenzamide |
|---|---|
| PubChem CID | 173468677 |
| Molecular Formula | C26H22N2O3 |
| Molecular Weight | 410.47 g/mol |
| Exact Mass | 410.16 |
| IUPAC Name | N-[6-(2,3-dimethylphenoxy)-3-pyridinyl]-4-phenoxybenzamide |
| SMILES | Cc1cccc(Oc2ccc(NC(=O)c3ccc(Oc4ccccc4)cc3)cn2)c1C |
| InChI | InChI=1S/C26H22N2O3/c1-18-7-6-10-24(19(18)2)31-25-16-13-21(17-27-25)28-26(29)20-11-14-23(15-12-20)30-22-8-4-3-5-9-22/h3-17H,1-2H3,(H,28,29) |
| InChIKey | OWGWDMOJCUQZKY-UHFFFAOYSA-N |
| XLogP | 6.54 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.47 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |