C16H19N3O2 — CID 67235654
(2R)-2-amino-N-[6-(2,3-dimethylphenoxy)-3-pyridinyl]propanamide (PubChem CID 67235654) has the molecular formula C16H19N3O2 and a molecular weight of 285.35 g/mol. Its IUPAC name is (2R)-2-amino-N-[6-(2,3-dimethylphenoxy)-3-pyridinyl]propanamide.
| Compound Name | (2R)-2-amino-N-[6-(2,3-dimethylphenoxy)-3-pyridinyl]propanamide |
|---|---|
| PubChem CID | 67235654 |
| Molecular Formula | C16H19N3O2 |
| Molecular Weight | 285.35 g/mol |
| Exact Mass | 285.15 |
| IUPAC Name | (2R)-2-amino-N-[6-(2,3-dimethylphenoxy)-3-pyridinyl]propanamide |
| SMILES | Cc1cccc(Oc2ccc(NC(=O)[C@@H](C)N)cn2)c1C |
| InChI | InChI=1S/C16H19N3O2/c1-10-5-4-6-14(11(10)2)21-15-8-7-13(9-18-15)19-16(20)12(3)17/h4-9,12H,17H2,1-3H3,(H,19,20)/t12-/m1/s1 |
| InChIKey | HLWBAYJJHVFISN-GFCCVEGCSA-N |
| XLogP | 2.78 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.35 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |