C22H28N4O3S — CID 152980646
(2S)-2-benzhydryl-N'-methylsulfonyl-5-oxo-4-propan-2-ylpiperazine-1-carboximidamide (PubChem CID 152980646) has the molecular formula C22H28N4O3S and a molecular weight of 428.56 g/mol. Its IUPAC name is (2S)-2-benzhydryl-N'-methylsulfonyl-5-oxo-4-propan-2-ylpiperazine-1-carboximidamide.
| Compound Name | (2S)-2-benzhydryl-N'-methylsulfonyl-5-oxo-4-propan-2-ylpiperazine-1-carboximidamide |
|---|---|
| PubChem CID | 152980646 |
| Molecular Formula | C22H28N4O3S |
| Molecular Weight | 428.56 g/mol |
| Exact Mass | 428.19 |
| IUPAC Name | (2S)-2-benzhydryl-N'-methylsulfonyl-5-oxo-4-propan-2-ylpiperazine-1-carboximidamide |
| SMILES | CC(C)N1C[C@H](C(c2ccccc2)c2ccccc2)N(C(N)=NS(C)(=O)=O)CC1=O |
| InChI | InChI=1S/C22H28N4O3S/c1-16(2)25-14-19(26(15-20(25)27)22(23)24-30(3,28)29)21(17-10-6-4-7-11-17)18-12-8-5-9-13-18/h4-13,16,19,21H,14-15H2,1-3H3,(H2,23,24)/t19-/m1/s1 |
| InChIKey | UUHNDGJZDAVNBU-LJQANCHMSA-N |
| XLogP | 2.01 |
| TPSA | 96.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.56 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|