C22H27N3O2 — CID 129095959
methyl (2S)-2-benzhydryl-5-oxo-4-propan-2-ylpiperazine-1-carboximidate (PubChem CID 129095959) has the molecular formula C22H27N3O2 and a molecular weight of 365.48 g/mol. Its IUPAC name is methyl (2S)-2-benzhydryl-5-oxo-4-propan-2-ylpiperazine-1-carboximidate.
| Compound Name | methyl (2S)-2-benzhydryl-5-oxo-4-propan-2-ylpiperazine-1-carboximidate |
|---|---|
| PubChem CID | 129095959 |
| Molecular Formula | C22H27N3O2 |
| Molecular Weight | 365.48 g/mol |
| Exact Mass | 365.21 |
| IUPAC Name | methyl (2S)-2-benzhydryl-5-oxo-4-propan-2-ylpiperazine-1-carboximidate |
| SMILES | [H]/N=C(\OC)N1CC(=O)N(C(C)C)C[C@@H]1C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H27N3O2/c1-16(2)24-14-19(25(15-20(24)26)22(23)27-3)21(17-10-6-4-7-11-17)18-12-8-5-9-13-18/h4-13,16,19,21,23H,14-15H2,1-3H3/b23-22-/t19-/m1/s1 |
| InChIKey | NJDMERDLHPHALK-VLZBMTSBSA-N |
| XLogP | 3.32 |
| TPSA | 56.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.48 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|