C27H24BrN5O3 — CID 153000830
2-[2-[2-(4-benzoylpiperazin-1-yl)-2-oxoethyl]indazol-5-yl]-1-(6-bromo-2-pyridinyl)ethanone (PubChem CID 153000830) has the molecular formula C27H24BrN5O3 and a molecular weight of 546.43 g/mol. Its IUPAC name is 2-[2-[2-(4-benzoylpiperazin-1-yl)-2-oxoethyl]indazol-5-yl]-1-(6-bromo-2-pyridinyl)ethanone.
| Compound Name | 2-[2-[2-(4-benzoylpiperazin-1-yl)-2-oxoethyl]indazol-5-yl]-1-(6-bromo-2-pyridinyl)ethanone |
|---|---|
| PubChem CID | 153000830 |
| Molecular Formula | C27H24BrN5O3 |
| Molecular Weight | 546.43 g/mol |
| Exact Mass | 545.11 |
| IUPAC Name | 2-[2-[2-(4-benzoylpiperazin-1-yl)-2-oxoethyl]indazol-5-yl]-1-(6-bromo-2-pyridinyl)ethanone |
| SMILES | O=C(Cc1ccc2nn(CC(=O)N3CCN(C(=O)c4ccccc4)CC3)cc2c1)c1cccc(Br)n1 |
| InChI | InChI=1S/C27H24BrN5O3/c28-25-8-4-7-23(29-25)24(34)16-19-9-10-22-21(15-19)17-33(30-22)18-26(35)31-11-13-32(14-12-31)27(36)20-5-2-1-3-6-20/h1-10,15,17H,11-14,16,18H2 |
| InChIKey | UYCYWYFRCUWZJG-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 88.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.43 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|