C30H48N8S3 — CID 15300379
39,40,41-trithia-1,4,11,14,17,24,29,36-octazapentacyclo[12.12.12.16,9.119,22.131,34]hentetraconta-6,8,19,21,31,33-hexaene (PubChem CID 15300379) has the molecular formula C30H48N8S3 and a molecular weight of 616.97 g/mol. Its IUPAC name is 39,40,41-trithia-1,4,11,14,17,24,29,36-octazapentacyclo[12.12.12.16,9.119,22.131,34]hentetraconta-6,8,19,21,31,33-hexaene.
| Compound Name | 39,40,41-trithia-1,4,11,14,17,24,29,36-octazapentacyclo[12.12.12.16,9.119,22.131,34]hentetraconta-6,8,19,21,31,33-hexaene |
|---|---|
| PubChem CID | 15300379 |
| Molecular Formula | C30H48N8S3 |
| Molecular Weight | 616.97 g/mol |
| Exact Mass | 616.32 |
| IUPAC Name | 39,40,41-trithia-1,4,11,14,17,24,29,36-octazapentacyclo[12.12.12.16,9.119,22.131,34]hentetraconta-6,8,19,21,31,33-hexaene |
| SMILES | c1cc2sc1CNCCN1CCNCc3ccc(s3)CNCCN(CCNC2)CCNCc2ccc(s2)CNCC1 |
| InChI | InChI=1S/C30H48N8S3/c1-2-26-20-32-8-14-38-17-11-35-23-29-5-3-27(40-29)21-33-9-15-37(13-7-31-19-25(1)39-26)16-10-34-22-28-4-6-30(41-28)24-36-12-18-38/h1-6,31-36H,7-24H2 |
| InChIKey | MANKGKJWKIAOBA-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 78.66 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | |
| Heavy Atoms | 41 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.97 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |