C15H17FN4 — CID 153006204
1-[6-[(3E,5E)-6-fluoro-5-methylhexa-1,3,5-trien-3-yl]-[1,2,4]triazolo[4,3-a]pyridin-3-yl]-N-methylmethanamine (PubChem CID 153006204) has the molecular formula C15H17FN4 and a molecular weight of 272.33 g/mol. Its IUPAC name is 1-[6-[(3E,5E)-6-fluoro-5-methylhexa-1,3,5-trien-3-yl]-[1,2,4]triazolo[4,3-a]pyridin-3-yl]-N-methylmethanamine.
| Compound Name | 1-[6-[(3E,5E)-6-fluoro-5-methylhexa-1,3,5-trien-3-yl]-[1,2,4]triazolo[4,3-a]pyridin-3-yl]-N-methylmethanamine |
|---|---|
| PubChem CID | 153006204 |
| Molecular Formula | C15H17FN4 |
| Molecular Weight | 272.33 g/mol |
| Exact Mass | 272.14 |
| IUPAC Name | 1-[6-[(3E,5E)-6-fluoro-5-methylhexa-1,3,5-trien-3-yl]-[1,2,4]triazolo[4,3-a]pyridin-3-yl]-N-methylmethanamine |
| SMILES | C=C/C(=C\C(C)=C\F)c1ccc2nnc(CNC)n2c1 |
| InChI | InChI=1S/C15H17FN4/c1-4-12(7-11(2)8-16)13-5-6-14-18-19-15(9-17-3)20(14)10-13/h4-8,10,17H,1,9H2,2-3H3/b11-8+,12-7+ |
| InChIKey | UZDQQPNULOCTBY-NFLJZBCPSA-N |
| XLogP | 2.89 |
| TPSA | 42.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.33 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|