C24H26FN3O4S — CID 15300997
O-[3-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]propyl] N-(2,3-dihydro-1,4-benzodioxin-6-yl)carbamothioate (PubChem CID 15300997) has the molecular formula C24H26FN3O4S and a molecular weight of 471.55 g/mol. Its IUPAC name is O-[3-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]propyl] N-(2,3-dihydro-1,4-benzodioxin-6-yl)carbamothioate.
| Compound Name | O-[3-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]propyl] N-(2,3-dihydro-1,4-benzodioxin-6-yl)carbamothioate |
|---|---|
| PubChem CID | 15300997 |
| Molecular Formula | C24H26FN3O4S |
| Molecular Weight | 471.55 g/mol |
| Exact Mass | 471.16 |
| IUPAC Name | O-[3-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]propyl] N-(2,3-dihydro-1,4-benzodioxin-6-yl)carbamothioate |
| SMILES | Fc1ccc2c(C3CCN(CCCOC(=S)Nc4ccc5c(c4)OCCO5)CC3)noc2c1 |
| InChI | InChI=1S/C24H26FN3O4S/c25-17-2-4-19-21(14-17)32-27-23(19)16-6-9-28(10-7-16)8-1-11-31-24(33)26-18-3-5-20-22(15-18)30-13-12-29-20/h2-5,14-16H,1,6-13H2,(H,26,33) |
| InChIKey | MDKXMXWTPVHQQC-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 68.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.55 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|