C33H47F3N2O3 — CID 153024968
(4aS,6aR,6bR,12aR)-11-cyano-10-hydroxy-2,2,6a,6b,9,9,12a-heptamethyl-14-oxo-N-(2,2,2-trifluoroethyl)-3,4,5,6,6a,7,8,8a,10,13,14a,14b-dodecahydro-1H-picene-4a-carboxamide (PubChem CID 153024968) has the molecular formula C33H47F3N2O3 and a molecular weight of 576.74 g/mol. Its IUPAC name is (4aS,6aR,6bR,12aR)-11-cyano-10-hydroxy-2,2,6a,6b,9,9,12a-heptamethyl-14-oxo-N-(2,2,2-trifluoroethyl)-3,4,5,6,6a,7,8,8a,10,13,14a,14b-dodecahydro-1H-picene-4a-carboxamide.
| Compound Name | (4aS,6aR,6bR,12aR)-11-cyano-10-hydroxy-2,2,6a,6b,9,9,12a-heptamethyl-14-oxo-N-(2,2,2-trifluoroethyl)-3,4,5,6,6a,7,8,8a,10,13,14a,14b-dodecahydro-1H-picene-4a-carboxamide |
|---|---|
| PubChem CID | 153024968 |
| Molecular Formula | C33H47F3N2O3 |
| Molecular Weight | 576.74 g/mol |
| Exact Mass | 576.35 |
| IUPAC Name | (4aS,6aR,6bR,12aR)-11-cyano-10-hydroxy-2,2,6a,6b,9,9,12a-heptamethyl-14-oxo-N-(2,2,2-trifluoroethyl)-3,4,5,6,6a,7,8,8a,10,13,14a,14b-dodecahydro-1H-picene-4a-carboxamide |
| SMILES | CC1(C)CC[C@]2(C(=O)NCC(F)(F)F)CC[C@]3(C)C(C(=O)CC4[C@@]5(C)C=C(C#N)C(O)C(C)(C)C5CC[C@]43C)C2C1 |
| InChI | InChI=1S/C33H47F3N2O3/c1-27(2)10-12-32(26(41)38-18-33(34,35)36)13-11-31(7)24(20(32)16-27)21(39)14-23-29(5)15-19(17-37)25(40)28(3,4)22(29)8-9-30(23,31)6/h15,20,22-25,40H,8-14,16,18H2,1-7H3,(H,38,41)/t20?,22?,23?,24?,25?,29-,30+,31+,32-/m0/s1 |
| InChIKey | VCRCUPBQWYLFDC-OVAHJWMWSA-N |
| XLogP | 6.76 |
| TPSA | 90.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.74 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |