C69H46N8 — CID 153028901
11-[4-[4-(9,9-dimethylfluoren-1-yl)-6-phenyl-1,3,5-triazin-2-yl]-2-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-5-phenylindolo[3,2-b]carbazole (PubChem CID 153028901) has the molecular formula C69H46N8 and a molecular weight of 987.18 g/mol. Its IUPAC name is 11-[4-[4-(9,9-dimethylfluoren-1-yl)-6-phenyl-1,3,5-triazin-2-yl]-2-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-5-phenylindolo[3,2-b]carbazole.
| Compound Name | 11-[4-[4-(9,9-dimethylfluoren-1-yl)-6-phenyl-1,3,5-triazin-2-yl]-2-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-5-phenylindolo[3,2-b]carbazole |
|---|---|
| PubChem CID | 153028901 |
| Molecular Formula | C69H46N8 |
| Molecular Weight | 987.18 g/mol |
| Exact Mass | 986.38 |
| IUPAC Name | 11-[4-[4-(9,9-dimethylfluoren-1-yl)-6-phenyl-1,3,5-triazin-2-yl]-2-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-5-phenylindolo[3,2-b]carbazole |
| SMILES | CC1(C)c2ccccc2-c2cccc(-c3nc(-c4ccccc4)nc(-c4ccc(-n5c6ccccc6c6cc7c(cc65)c5ccccc5n7-c5ccccc5)c(-c5nc(-c6ccccc6)nc(-c6ccccc6)n5)c4)n3)c21 |
| InChI | InChI=1S/C69H46N8/c1-69(2)56-35-18-15-30-48(56)51-33-21-34-52(62(51)69)67-72-65(45-26-11-5-12-27-45)71-66(75-67)46-38-39-59(55(40-46)68-73-63(43-22-7-3-8-23-43)70-64(74-68)44-24-9-4-10-25-44)77-58-37-20-17-32-50(58)54-41-60-53(42-61(54)77)49-31-16-19-36-57(49)76(60)47-28-13-6-14-29-47/h3-42H,1-2H3 |
| InChIKey | VDKMZBVBRYFYQJ-UHFFFAOYSA-N |
| XLogP | 16.56 |
| TPSA | 87.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 77 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 987.18 |
| LogP ≤ 5 | 16.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |