C24H29N3O4S2 — CID 153042857
N-[(12aS)-9-hydroxy-8-methoxy-6-oxo-11,12,12a,13-tetrahydroindolo[2,1-c][1,4]benzodiazepin-3-yl]-4-methyl-4-(methyldisulfanyl)pentanamide (PubChem CID 153042857) has the molecular formula C24H29N3O4S2 and a molecular weight of 487.65 g/mol. Its IUPAC name is N-[(12aS)-9-hydroxy-8-methoxy-6-oxo-11,12,12a,13-tetrahydroindolo[2,1-c][1,4]benzodiazepin-3-yl]-4-methyl-4-(methyldisulfanyl)pentanamide.
| Compound Name | N-[(12aS)-9-hydroxy-8-methoxy-6-oxo-11,12,12a,13-tetrahydroindolo[2,1-c][1,4]benzodiazepin-3-yl]-4-methyl-4-(methyldisulfanyl)pentanamide |
|---|---|
| PubChem CID | 153042857 |
| Molecular Formula | C24H29N3O4S2 |
| Molecular Weight | 487.65 g/mol |
| Exact Mass | 487.16 |
| IUPAC Name | N-[(12aS)-9-hydroxy-8-methoxy-6-oxo-11,12,12a,13-tetrahydroindolo[2,1-c][1,4]benzodiazepin-3-yl]-4-methyl-4-(methyldisulfanyl)pentanamide |
| SMILES | COc1cc2c(cc1O)NC[C@@H]1Cc3ccc(NC(=O)CCC(C)(C)SSC)cc3N1C2=O |
| InChI | InChI=1S/C24H29N3O4S2/c1-24(2,33-32-4)8-7-22(29)26-15-6-5-14-9-16-13-25-18-12-20(28)21(31-3)11-17(18)23(30)27(16)19(14)10-15/h5-6,10-12,16,25,28H,7-9,13H2,1-4H3,(H,26,29)/t16-/m0/s1 |
| InChIKey | VGANFPSYWKVFBH-INIZCTEOSA-N |
| XLogP | 4.91 |
| TPSA | 90.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.65 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|