C20H12F4N3O4S+ — CID 153043652
5-[[3-fluoro-4-(5-oxo-4H-1,2,4-oxadiazol-4-ium-3-yl)phenoxy]methyl]-2-[4-(trifluoromethyl)phenyl]-1,3-thiazole-4-carbaldehyde (PubChem CID 153043652) has the molecular formula C20H12F4N3O4S+ and a molecular weight of 466.39 g/mol. Its IUPAC name is 5-[[3-fluoro-4-(5-oxo-4H-1,2,4-oxadiazol-4-ium-3-yl)phenoxy]methyl]-2-[4-(trifluoromethyl)phenyl]-1,3-thiazole-4-carbaldehyde.
| Compound Name | 5-[[3-fluoro-4-(5-oxo-4H-1,2,4-oxadiazol-4-ium-3-yl)phenoxy]methyl]-2-[4-(trifluoromethyl)phenyl]-1,3-thiazole-4-carbaldehyde |
|---|---|
| PubChem CID | 153043652 |
| Molecular Formula | C20H12F4N3O4S+ |
| Molecular Weight | 466.39 g/mol |
| Exact Mass | 466.05 |
| IUPAC Name | 5-[[3-fluoro-4-(5-oxo-4H-1,2,4-oxadiazol-4-ium-3-yl)phenoxy]methyl]-2-[4-(trifluoromethyl)phenyl]-1,3-thiazole-4-carbaldehyde |
| SMILES | O=Cc1nc(-c2ccc(C(F)(F)F)cc2)sc1COc1ccc(C2=NOC(=O)[NH2+]2)c(F)c1 |
| InChI | InChI=1S/C20H11F4N3O4S/c21-14-7-12(5-6-13(14)17-26-19(29)31-27-17)30-9-16-15(8-28)25-18(32-16)10-1-3-11(4-2-10)20(22,23)24/h1-8H,9H2,(H,26,27,29)/p+1 |
| InChIKey | VGEIHDUSYSEMHN-UHFFFAOYSA-O |
| XLogP | 3.73 |
| TPSA | 94.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.39 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'} |
|---|