C20H16F4N4O3S — CID 162583003
(Z)-[amino-[4-[[4-(aminomethyl)-2-[4-(trifluoromethyl)phenyl]-1,3-thiazol-5-yl]methoxy]-2-fluorophenyl]methylidene]carbamic acid (PubChem CID 162583003) has the molecular formula C20H16F4N4O3S and a molecular weight of 468.43 g/mol. Its IUPAC name is (Z)-[amino-[4-[[4-(aminomethyl)-2-[4-(trifluoromethyl)phenyl]-1,3-thiazol-5-yl]methoxy]-2-fluorophenyl]methylidene]carbamic acid.
| Compound Name | (Z)-[amino-[4-[[4-(aminomethyl)-2-[4-(trifluoromethyl)phenyl]-1,3-thiazol-5-yl]methoxy]-2-fluorophenyl]methylidene]carbamic acid |
|---|---|
| PubChem CID | 162583003 |
| Molecular Formula | C20H16F4N4O3S |
| Molecular Weight | 468.43 g/mol |
| Exact Mass | 468.09 |
| IUPAC Name | (Z)-[amino-[4-[[4-(aminomethyl)-2-[4-(trifluoromethyl)phenyl]-1,3-thiazol-5-yl]methoxy]-2-fluorophenyl]methylidene]carbamic acid |
| SMILES | NCc1nc(-c2ccc(C(F)(F)F)cc2)sc1COc1ccc(/C(N)=N/C(=O)O)c(F)c1 |
| InChI | InChI=1S/C20H16F4N4O3S/c21-14-7-12(5-6-13(14)17(26)28-19(29)30)31-9-16-15(8-25)27-18(32-16)10-1-3-11(4-2-10)20(22,23)24/h1-7H,8-9,25H2,(H2,26,28)(H,29,30) |
| InChIKey | VZBWKSCCECEISD-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 123.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.43 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|