C29H33F3N4O4S — CID 88870274
[(E)-1-[2-methyl-4-[[4-[(2-morpholin-4-ylethylamino)methyl]-2-[4-(trifluoromethyl)phenyl]-1,3-thiazol-5-yl]methoxy]phenyl]ethylideneamino] acetate (PubChem CID 88870274) has the molecular formula C29H33F3N4O4S and a molecular weight of 590.67 g/mol. Its IUPAC name is [(E)-1-[2-methyl-4-[[4-[(2-morpholin-4-ylethylamino)methyl]-2-[4-(trifluoromethyl)phenyl]-1,3-thiazol-5-yl]methoxy]phenyl]ethylideneamino] acetate.
| Compound Name | [(E)-1-[2-methyl-4-[[4-[(2-morpholin-4-ylethylamino)methyl]-2-[4-(trifluoromethyl)phenyl]-1,3-thiazol-5-yl]methoxy]phenyl]ethylideneamino] acetate |
|---|---|
| PubChem CID | 88870274 |
| Molecular Formula | C29H33F3N4O4S |
| Molecular Weight | 590.67 g/mol |
| Exact Mass | 590.22 |
| IUPAC Name | [(E)-1-[2-methyl-4-[[4-[(2-morpholin-4-ylethylamino)methyl]-2-[4-(trifluoromethyl)phenyl]-1,3-thiazol-5-yl]methoxy]phenyl]ethylideneamino] acetate |
| SMILES | CC(=O)O/N=C(\C)c1ccc(OCc2sc(-c3ccc(C(F)(F)F)cc3)nc2CNCCN2CCOCC2)cc1C |
| InChI | InChI=1S/C29H33F3N4O4S/c1-19-16-24(8-9-25(19)20(2)35-40-21(3)37)39-18-27-26(17-33-10-11-36-12-14-38-15-13-36)34-28(41-27)22-4-6-23(7-5-22)29(30,31)32/h4-9,16,33H,10-15,17-18H2,1-3H3/b35-20+ |
| InChIKey | OQZKOBIAFXOBPE-JEPNHJGPSA-N |
| XLogP | 5.43 |
| TPSA | 85.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.67 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|