C31H32F2N4O3S2 — CID 153045294
1-[2-[(1R,2R)-2-[2-(2,4-difluoroanilino)-5-[4-(1,1-dioxo-1,4-thiazinan-4-yl)phenyl]-1,3-thiazol-4-yl]cyclohexyl]-2-oxoethyl]cyclopropane-1-carbonitrile (PubChem CID 153045294) has the molecular formula C31H32F2N4O3S2 and a molecular weight of 610.75 g/mol. Its IUPAC name is 1-[2-[(1R,2R)-2-[2-(2,4-difluoroanilino)-5-[4-(1,1-dioxo-1,4-thiazinan-4-yl)phenyl]-1,3-thiazol-4-yl]cyclohexyl]-2-oxoethyl]cyclopropane-1-carbonitrile.
| Compound Name | 1-[2-[(1R,2R)-2-[2-(2,4-difluoroanilino)-5-[4-(1,1-dioxo-1,4-thiazinan-4-yl)phenyl]-1,3-thiazol-4-yl]cyclohexyl]-2-oxoethyl]cyclopropane-1-carbonitrile |
|---|---|
| PubChem CID | 153045294 |
| Molecular Formula | C31H32F2N4O3S2 |
| Molecular Weight | 610.75 g/mol |
| Exact Mass | 610.19 |
| IUPAC Name | 1-[2-[(1R,2R)-2-[2-(2,4-difluoroanilino)-5-[4-(1,1-dioxo-1,4-thiazinan-4-yl)phenyl]-1,3-thiazol-4-yl]cyclohexyl]-2-oxoethyl]cyclopropane-1-carbonitrile |
| SMILES | N#CC1(CC(=O)[C@@H]2CCCC[C@H]2c2nc(Nc3ccc(F)cc3F)sc2-c2ccc(N3CCS(=O)(=O)CC3)cc2)CC1 |
| InChI | InChI=1S/C31H32F2N4O3S2/c32-21-7-10-26(25(33)17-21)35-30-36-28(24-4-2-1-3-23(24)27(38)18-31(19-34)11-12-31)29(41-30)20-5-8-22(9-6-20)37-13-15-42(39,40)16-14-37/h5-10,17,23-24H,1-4,11-16,18H2,(H,35,36)/t23-,24-/m1/s1 |
| InChIKey | VGMHTCAUOXPJOF-DNQXCXABSA-N |
| XLogP | 6.60 |
| TPSA | 103.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.75 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |