C26H29F3N4O4S2 — CID 118018116
trans-(1R,2R)-N-(1-cyanocyclopropyl)-2-[5-[4-(1,1-dioxo-1,4-thiazinan-4-yl)phenyl]-2-(2,2,2-trifluoro-1-hydroxyethyl)-1,3-thiazol-4-yl]cyclohexane-1-carboxamide (PubChem CID 118018116) has the molecular formula C26H29F3N4O4S2 and a molecular weight of 582.67 g/mol. Its IUPAC name is trans-(1R,2R)-N-(1-cyanocyclopropyl)-2-[5-[4-(1,1-dioxo-1,4-thiazinan-4-yl)phenyl]-2-(2,2,2-trifluoro-1-hydroxyethyl)-1,3-thiazol-4-yl]cyclohexane-1-carboxamide.
| Compound Name | trans-(1R,2R)-N-(1-cyanocyclopropyl)-2-[5-[4-(1,1-dioxo-1,4-thiazinan-4-yl)phenyl]-2-(2,2,2-trifluoro-1-hydroxyethyl)-1,3-thiazol-4-yl]cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 118018116 |
| Molecular Formula | C26H29F3N4O4S2 |
| Molecular Weight | 582.67 g/mol |
| Exact Mass | 582.16 |
| IUPAC Name | trans-(1R,2R)-N-(1-cyanocyclopropyl)-2-[5-[4-(1,1-dioxo-1,4-thiazinan-4-yl)phenyl]-2-(2,2,2-trifluoro-1-hydroxyethyl)-1,3-thiazol-4-yl]cyclohexane-1-carboxamide |
| SMILES | N#CC1(NC(=O)[C@@H]2CCCC[C@H]2c2nc(C(O)C(F)(F)F)sc2-c2ccc(N3CCS(=O)(=O)CC3)cc2)CC1 |
| InChI | InChI=1S/C26H29F3N4O4S2/c27-26(28,29)22(34)24-31-20(18-3-1-2-4-19(18)23(35)32-25(15-30)9-10-25)21(38-24)16-5-7-17(8-6-16)33-11-13-39(36,37)14-12-33/h5-8,18-19,22,34H,1-4,9-14H2,(H,32,35)/t18-,19-,22?/m1/s1 |
| InChIKey | WPKJBQZUGSMFNY-IERKJGKXSA-N |
| XLogP | 4.09 |
| TPSA | 123.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.67 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |