C29H34F2N4O3S2 — CID 118016965
trans-(1R,2R)-N-(1-cyanocyclopropyl)-2-[2-(3,3-difluorocyclopentyl)-5-[4-(1,1-dioxo-1,4-thiazinan-4-yl)phenyl]-1,3-thiazol-4-yl]cyclohexane-1-carboxamide (PubChem CID 118016965) has the molecular formula C29H34F2N4O3S2 and a molecular weight of 588.75 g/mol. Its IUPAC name is trans-(1R,2R)-N-(1-cyanocyclopropyl)-2-[2-(3,3-difluorocyclopentyl)-5-[4-(1,1-dioxo-1,4-thiazinan-4-yl)phenyl]-1,3-thiazol-4-yl]cyclohexane-1-carboxamide.
| Compound Name | trans-(1R,2R)-N-(1-cyanocyclopropyl)-2-[2-(3,3-difluorocyclopentyl)-5-[4-(1,1-dioxo-1,4-thiazinan-4-yl)phenyl]-1,3-thiazol-4-yl]cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 118016965 |
| Molecular Formula | C29H34F2N4O3S2 |
| Molecular Weight | 588.75 g/mol |
| Exact Mass | 588.20 |
| IUPAC Name | trans-(1R,2R)-N-(1-cyanocyclopropyl)-2-[2-(3,3-difluorocyclopentyl)-5-[4-(1,1-dioxo-1,4-thiazinan-4-yl)phenyl]-1,3-thiazol-4-yl]cyclohexane-1-carboxamide |
| SMILES | N#CC1(NC(=O)[C@@H]2CCCC[C@H]2c2nc(C3CCC(F)(F)C3)sc2-c2ccc(N3CCS(=O)(=O)CC3)cc2)CC1 |
| InChI | InChI=1S/C29H34F2N4O3S2/c30-29(31)10-9-20(17-29)27-33-24(22-3-1-2-4-23(22)26(36)34-28(18-32)11-12-28)25(39-27)19-5-7-21(8-6-19)35-13-15-40(37,38)16-14-35/h5-8,20,22-23H,1-4,9-17H2,(H,34,36)/t20?,22-,23-/m1/s1 |
| InChIKey | KFIDJWDHPDDYEI-JHRSTNGLSA-N |
| XLogP | 5.39 |
| TPSA | 103.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.75 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |