C28H33F3N4O3S2 — CID 118009500
(1R,2R,5S)-N-(1-cyanocyclopropyl)-2-[2-(3,3-difluorocyclobutyl)-5-[4-(1,1-dihydroxy-1,4-thiazinan-4-yl)phenyl]-1,3-thiazol-4-yl]-5-fluorocyclohexane-1-carboxamide (PubChem CID 118009500) has the molecular formula C28H33F3N4O3S2 and a molecular weight of 594.73 g/mol. Its IUPAC name is (1R,2R,5S)-N-(1-cyanocyclopropyl)-2-[2-(3,3-difluorocyclobutyl)-5-[4-(1,1-dihydroxy-1,4-thiazinan-4-yl)phenyl]-1,3-thiazol-4-yl]-5-fluorocyclohexane-1-carboxamide.
| Compound Name | (1R,2R,5S)-N-(1-cyanocyclopropyl)-2-[2-(3,3-difluorocyclobutyl)-5-[4-(1,1-dihydroxy-1,4-thiazinan-4-yl)phenyl]-1,3-thiazol-4-yl]-5-fluorocyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 118009500 |
| Molecular Formula | C28H33F3N4O3S2 |
| Molecular Weight | 594.73 g/mol |
| Exact Mass | 594.19 |
| IUPAC Name | (1R,2R,5S)-N-(1-cyanocyclopropyl)-2-[2-(3,3-difluorocyclobutyl)-5-[4-(1,1-dihydroxy-1,4-thiazinan-4-yl)phenyl]-1,3-thiazol-4-yl]-5-fluorocyclohexane-1-carboxamide |
| SMILES | N#CC1(NC(=O)[C@@H]2C[C@@H](F)CC[C@H]2c2nc(C3CC(F)(F)C3)sc2-c2ccc(N3CCS(O)(O)CC3)cc2)CC1 |
| InChI | InChI=1S/C28H33F3N4O3S2/c29-19-3-6-21(22(13-19)25(36)34-27(16-32)7-8-27)23-24(39-26(33-23)18-14-28(30,31)15-18)17-1-4-20(5-2-17)35-9-11-40(37,38)12-10-35/h1-2,4-5,18-19,21-22,37-38H,3,6-15H2,(H,34,36)/t19-,21+,22+/m0/s1 |
| InChIKey | LVBBAYKMDJBPFS-KSEOMHKRSA-N |
| XLogP | 6.29 |
| TPSA | 109.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.73 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |