C26H27F5N4O3S2 — CID 140735263
N-(1-cyanocyclopropyl)-2-[5-[4-(1,1-dioxo-1,4-thiazinan-4-yl)phenyl]-2-(2,2,2-trifluoroethyl)-1,3-thiazol-4-yl]-5,5-difluorocyclohexane-1-carboxamide (PubChem CID 140735263) has the molecular formula C26H27F5N4O3S2 and a molecular weight of 602.65 g/mol. Its IUPAC name is N-(1-cyanocyclopropyl)-2-[5-[4-(1,1-dioxo-1,4-thiazinan-4-yl)phenyl]-2-(2,2,2-trifluoroethyl)-1,3-thiazol-4-yl]-5,5-difluorocyclohexane-1-carboxamide.
| Compound Name | N-(1-cyanocyclopropyl)-2-[5-[4-(1,1-dioxo-1,4-thiazinan-4-yl)phenyl]-2-(2,2,2-trifluoroethyl)-1,3-thiazol-4-yl]-5,5-difluorocyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 140735263 |
| Molecular Formula | C26H27F5N4O3S2 |
| Molecular Weight | 602.65 g/mol |
| Exact Mass | 602.14 |
| IUPAC Name | N-(1-cyanocyclopropyl)-2-[5-[4-(1,1-dioxo-1,4-thiazinan-4-yl)phenyl]-2-(2,2,2-trifluoroethyl)-1,3-thiazol-4-yl]-5,5-difluorocyclohexane-1-carboxamide |
| SMILES | N#CC1(NC(=O)C2CC(F)(F)CCC2c2nc(CC(F)(F)F)sc2-c2ccc(N3CCS(=O)(=O)CC3)cc2)CC1 |
| InChI | InChI=1S/C26H27F5N4O3S2/c27-25(28)6-5-18(19(13-25)23(36)34-24(15-32)7-8-24)21-22(39-20(33-21)14-26(29,30)31)16-1-3-17(4-2-16)35-9-11-40(37,38)12-10-35/h1-4,18-19H,5-14H2,(H,34,36) |
| InChIKey | YWPDLMKMDLNDPY-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 103.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.65 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |