C26H29F3N4O4S — CID 123349177
N-(1-cyanocyclopropyl)-2-[4-[4-(1,1-dioxo-1,4-thiazinan-4-yl)phenyl]-2-(2,2,2-trifluoroethyl)-1,3-oxazol-5-yl]cyclohexane-1-carboxamide (PubChem CID 123349177) has the molecular formula C26H29F3N4O4S and a molecular weight of 550.60 g/mol. Its IUPAC name is N-(1-cyanocyclopropyl)-2-[4-[4-(1,1-dioxo-1,4-thiazinan-4-yl)phenyl]-2-(2,2,2-trifluoroethyl)-1,3-oxazol-5-yl]cyclohexane-1-carboxamide.
| Compound Name | N-(1-cyanocyclopropyl)-2-[4-[4-(1,1-dioxo-1,4-thiazinan-4-yl)phenyl]-2-(2,2,2-trifluoroethyl)-1,3-oxazol-5-yl]cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 123349177 |
| Molecular Formula | C26H29F3N4O4S |
| Molecular Weight | 550.60 g/mol |
| Exact Mass | 550.19 |
| IUPAC Name | N-(1-cyanocyclopropyl)-2-[4-[4-(1,1-dioxo-1,4-thiazinan-4-yl)phenyl]-2-(2,2,2-trifluoroethyl)-1,3-oxazol-5-yl]cyclohexane-1-carboxamide |
| SMILES | N#CC1(NC(=O)C2CCCCC2c2oc(CC(F)(F)F)nc2-c2ccc(N3CCS(=O)(=O)CC3)cc2)CC1 |
| InChI | InChI=1S/C26H29F3N4O4S/c27-26(28,29)15-21-31-22(17-5-7-18(8-6-17)33-11-13-38(35,36)14-12-33)23(37-21)19-3-1-2-4-20(19)24(34)32-25(16-30)9-10-25/h5-8,19-20H,1-4,9-15H2,(H,32,34) |
| InChIKey | YWZDMUVUXQYJTF-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 116.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.60 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |