C26H30F3N3O4S2 — CID 161293926
(2R)-4-[(1R,2R)-2-[5-[4-(1,1-dioxo-1,4-thiazinan-4-yl)phenyl]-2-(2,2,2-trifluoro-1-hydroxyethyl)-1,3-thiazol-4-yl]cyclohexyl]-2-methyl-4-oxobutanenitrile (PubChem CID 161293926) has the molecular formula C26H30F3N3O4S2 and a molecular weight of 569.67 g/mol. Its IUPAC name is (2R)-4-[(1R,2R)-2-[5-[4-(1,1-dioxo-1,4-thiazinan-4-yl)phenyl]-2-(2,2,2-trifluoro-1-hydroxyethyl)-1,3-thiazol-4-yl]cyclohexyl]-2-methyl-4-oxobutanenitrile.
| Compound Name | (2R)-4-[(1R,2R)-2-[5-[4-(1,1-dioxo-1,4-thiazinan-4-yl)phenyl]-2-(2,2,2-trifluoro-1-hydroxyethyl)-1,3-thiazol-4-yl]cyclohexyl]-2-methyl-4-oxobutanenitrile |
|---|---|
| PubChem CID | 161293926 |
| Molecular Formula | C26H30F3N3O4S2 |
| Molecular Weight | 569.67 g/mol |
| Exact Mass | 569.16 |
| IUPAC Name | (2R)-4-[(1R,2R)-2-[5-[4-(1,1-dioxo-1,4-thiazinan-4-yl)phenyl]-2-(2,2,2-trifluoro-1-hydroxyethyl)-1,3-thiazol-4-yl]cyclohexyl]-2-methyl-4-oxobutanenitrile |
| SMILES | C[C@@H](C#N)CC(=O)[C@@H]1CCCC[C@H]1c1nc(C(O)C(F)(F)F)sc1-c1ccc(N2CCS(=O)(=O)CC2)cc1 |
| InChI | InChI=1S/C26H30F3N3O4S2/c1-16(15-30)14-21(33)19-4-2-3-5-20(19)22-23(37-25(31-22)24(34)26(27,28)29)17-6-8-18(9-7-17)32-10-12-38(35,36)13-11-32/h6-9,16,19-20,24,34H,2-5,10-14H2,1H3/t16-,19-,20-,24?/m1/s1 |
| InChIKey | VGSLCJYMVNENNW-ZOICRDBHSA-N |
| XLogP | 5.03 |
| TPSA | 111.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.67 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |