C30H30F4N4O3S2 — CID 146716341
2-[2-[(1R,2R)-2-[5-[4-(1,1-dioxo-1,4-thiazinan-4-yl)phenyl]-2-(5-fluoro-2-pyridinyl)-1,3-thiazol-4-yl]cyclohexyl]-2-oxoethyl]-4,4,4-trifluorobutanenitrile (PubChem CID 146716341) has the molecular formula C30H30F4N4O3S2 and a molecular weight of 634.72 g/mol. Its IUPAC name is 2-[2-[(1R,2R)-2-[5-[4-(1,1-dioxo-1,4-thiazinan-4-yl)phenyl]-2-(5-fluoro-2-pyridinyl)-1,3-thiazol-4-yl]cyclohexyl]-2-oxoethyl]-4,4,4-trifluorobutanenitrile.
| Compound Name | 2-[2-[(1R,2R)-2-[5-[4-(1,1-dioxo-1,4-thiazinan-4-yl)phenyl]-2-(5-fluoro-2-pyridinyl)-1,3-thiazol-4-yl]cyclohexyl]-2-oxoethyl]-4,4,4-trifluorobutanenitrile |
|---|---|
| PubChem CID | 146716341 |
| Molecular Formula | C30H30F4N4O3S2 |
| Molecular Weight | 634.72 g/mol |
| Exact Mass | 634.17 |
| IUPAC Name | 2-[2-[(1R,2R)-2-[5-[4-(1,1-dioxo-1,4-thiazinan-4-yl)phenyl]-2-(5-fluoro-2-pyridinyl)-1,3-thiazol-4-yl]cyclohexyl]-2-oxoethyl]-4,4,4-trifluorobutanenitrile |
| SMILES | N#CC(CC(=O)[C@@H]1CCCC[C@H]1c1nc(-c2ccc(F)cn2)sc1-c1ccc(N2CCS(=O)(=O)CC2)cc1)CC(F)(F)F |
| InChI | InChI=1S/C30H30F4N4O3S2/c31-21-7-10-25(36-18-21)29-37-27(24-4-2-1-3-23(24)26(39)15-19(17-35)16-30(32,33)34)28(42-29)20-5-8-22(9-6-20)38-11-13-43(40,41)14-12-38/h5-10,18-19,23-24H,1-4,11-16H2/t19?,23-,24-/m1/s1 |
| InChIKey | RDOVYMHMKXUNMX-QLGUMYEUSA-N |
| XLogP | 6.57 |
| TPSA | 104.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.72 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |