C30H29Cl2FN4O3S2 — CID 149074155
1-[2-[(1R,2R)-4,4-dichloro-2-[5-[4-(1,1-dioxo-1,4-thiazinan-4-yl)phenyl]-2-(5-fluoro-2-pyridinyl)-1,3-thiazol-4-yl]cyclohexyl]-2-oxoethyl]cyclopropane-1-carbonitrile (PubChem CID 149074155) has the molecular formula C30H29Cl2FN4O3S2 and a molecular weight of 647.63 g/mol. Its IUPAC name is 1-[2-[(1R,2R)-4,4-dichloro-2-[5-[4-(1,1-dioxo-1,4-thiazinan-4-yl)phenyl]-2-(5-fluoro-2-pyridinyl)-1,3-thiazol-4-yl]cyclohexyl]-2-oxoethyl]cyclopropane-1-carbonitrile.
| Compound Name | 1-[2-[(1R,2R)-4,4-dichloro-2-[5-[4-(1,1-dioxo-1,4-thiazinan-4-yl)phenyl]-2-(5-fluoro-2-pyridinyl)-1,3-thiazol-4-yl]cyclohexyl]-2-oxoethyl]cyclopropane-1-carbonitrile |
|---|---|
| PubChem CID | 149074155 |
| Molecular Formula | C30H29Cl2FN4O3S2 |
| Molecular Weight | 647.63 g/mol |
| Exact Mass | 646.10 |
| IUPAC Name | 1-[2-[(1R,2R)-4,4-dichloro-2-[5-[4-(1,1-dioxo-1,4-thiazinan-4-yl)phenyl]-2-(5-fluoro-2-pyridinyl)-1,3-thiazol-4-yl]cyclohexyl]-2-oxoethyl]cyclopropane-1-carbonitrile |
| SMILES | N#CC1(CC(=O)[C@@H]2CCC(Cl)(Cl)C[C@H]2c2nc(-c3ccc(F)cn3)sc2-c2ccc(N3CCS(=O)(=O)CC3)cc2)CC1 |
| InChI | InChI=1S/C30H29Cl2FN4O3S2/c31-30(32)8-7-22(25(38)16-29(18-34)9-10-29)23(15-30)26-27(41-28(36-26)24-6-3-20(33)17-35-24)19-1-4-21(5-2-19)37-11-13-42(39,40)14-12-37/h1-6,17,22-23H,7-16H2/t22-,23-/m1/s1 |
| InChIKey | QOOLISDWTRBVEA-DHIUTWEWSA-N |
| XLogP | 6.57 |
| TPSA | 104.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.63 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|