C31H30F3N3O4S — CID 147477398
1-[2-[(1R,2R)-2-[4-[4-(1,1-dioxo-1,4-thiazinan-4-yl)phenyl]-2-(4-fluorophenyl)-1,3-oxazol-5-yl]-4,4-difluorocyclohexyl]-2-oxoethyl]cyclopropane-1-carbonitrile (PubChem CID 147477398) has the molecular formula C31H30F3N3O4S and a molecular weight of 597.66 g/mol. Its IUPAC name is 1-[2-[(1R,2R)-2-[4-[4-(1,1-dioxo-1,4-thiazinan-4-yl)phenyl]-2-(4-fluorophenyl)-1,3-oxazol-5-yl]-4,4-difluorocyclohexyl]-2-oxoethyl]cyclopropane-1-carbonitrile.
| Compound Name | 1-[2-[(1R,2R)-2-[4-[4-(1,1-dioxo-1,4-thiazinan-4-yl)phenyl]-2-(4-fluorophenyl)-1,3-oxazol-5-yl]-4,4-difluorocyclohexyl]-2-oxoethyl]cyclopropane-1-carbonitrile |
|---|---|
| PubChem CID | 147477398 |
| Molecular Formula | C31H30F3N3O4S |
| Molecular Weight | 597.66 g/mol |
| Exact Mass | 597.19 |
| IUPAC Name | 1-[2-[(1R,2R)-2-[4-[4-(1,1-dioxo-1,4-thiazinan-4-yl)phenyl]-2-(4-fluorophenyl)-1,3-oxazol-5-yl]-4,4-difluorocyclohexyl]-2-oxoethyl]cyclopropane-1-carbonitrile |
| SMILES | N#CC1(CC(=O)[C@@H]2CCC(F)(F)C[C@H]2c2oc(-c3ccc(F)cc3)nc2-c2ccc(N3CCS(=O)(=O)CC3)cc2)CC1 |
| InChI | InChI=1S/C31H30F3N3O4S/c32-22-5-1-21(2-6-22)29-36-27(20-3-7-23(8-4-20)37-13-15-42(39,40)16-14-37)28(41-29)25-17-31(33,34)10-9-24(25)26(38)18-30(19-35)11-12-30/h1-8,24-25H,9-18H2/t24-,25-/m1/s1 |
| InChIKey | FCYJRNNYQWDDNV-JWQCQUIFSA-N |
| XLogP | 6.16 |
| TPSA | 104.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.66 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |